CAS 1344046-07-6 appears in our catalog under these names: 3-Bromoquinolin-7-amine 95%, 3-Bromoquinolin-7-Amine, 98%, 98%, 3-Bromoquinolin-7-amine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromoquinolin-7-amine (CAS 1344046-07-6) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 3-bromoquinolin-7-amine. InChIKey: PUPYSBMMYVIJCB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 3-bromoquinolin-7-amine |
| InChIKey | PUPYSBMMYVIJCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)Br)N |
Computed by PubChem (NCBI)