CAS 13443-29-3 appears in our catalog under these names: Glycidyl benzoate, 95%, 95%, Oxiran-2-ylmethyl benzoate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Oxiran-2-ylmethyl benzoate (CAS 13443-29-3) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: oxiran-2-ylmethyl benzoate. InChIKey: XRQKARZTFMEBBY-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | oxiran-2-ylmethyl benzoate |
| InChIKey | XRQKARZTFMEBBY-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)