Products 1344364-90-4
CAS 1344364-90-4 is the registry number for 3-(3,5-Dichlorophenyl)-2,5-dimethylpyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-dichlorophenyl)-2,5-dimethylpyrrolidine (CAS 1344364-90-4) is a chemical compound with the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-2,5-dimethylpyrrolidine. InChIKey: GNZZVVIEBWYKRU-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)-2,5-dimethylpyrrolidine |
| InChIKey | GNZZVVIEBWYKRU-UHFFFAOYSA-N |
| SMILES | CC1CC(C(N1)C)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)