CAS 1344536-60-2 is the registry number for (S)-5-Bromo-4-chloro-2,3-dihydrobenzofuran-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-5-bromo-4-chloro-2,3-dihydro-1-benzofuran-3-amine (CAS 1344536-60-2) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: (3S)-5-bromo-4-chloro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: ARYZIMOKKNNSLX-RXMQYKEDSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | (3S)-5-bromo-4-chloro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | ARYZIMOKKNNSLX-RXMQYKEDSA-N |
| SMILES | C1[C@H](C2=C(O1)C=CC(=C2Cl)Br)N |
Computed by PubChem (NCBI)