CAS 1344557-18-1 appears in our catalog under these names: (alphaR)-alpha,5-Dimethyl-1-naphthalenemethanamine, Cinacalcet Impurity 40. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, on request.
(1R)-1-(5-methylnaphthalen-1-yl)ethanamine (CAS 1344557-18-1) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: (1R)-1-(5-methylnaphthalen-1-yl)ethanamine. InChIKey: GNCFOOKDAJHRQC-SNVBAGLBSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | (1R)-1-(5-methylnaphthalen-1-yl)ethanamine |
| InChIKey | GNCFOOKDAJHRQC-SNVBAGLBSA-N |
| SMILES | CC1=C2C=CC=C(C2=CC=C1)[C@@H](C)N |
Computed by PubChem (NCBI)