Products 1344715-94-1
CAS 1344715-94-1 is the registry number for Antiproliferative agent-20. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3,5,6-trimethylpyrazin-2-yl)methyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate (CAS 1344715-94-1) is a chemical compound with the molecular formula C23H18N2O6 and a molecular weight of 418.4 g/mol. IUPAC name: (3,5,6-trimethylpyrazin-2-yl)methyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate. InChIKey: WBNSFPYRPMFIMG-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O6 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | (3,5,6-trimethylpyrazin-2-yl)methyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate |
| InChIKey | WBNSFPYRPMFIMG-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C)COC(=O)C2=CC3=C(C(=C2)O)C(=O)C4=C(C3=O)C=CC=C4O)C |
Computed by PubChem (NCBI)
Synonyms:
Antiproliferative agent-20, orb1745073