Products 1998701-00-0
CAS 1998701-00-0 is the registry number for Fmoc-D-Phg(4-NO2)-OH, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-nitrophenyl)acetic acid (CAS 1998701-00-0) is a chemical compound with the molecular formula C23H18N2O6 and a molecular weight of 418.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-nitrophenyl)acetic acid. InChIKey: HEAJZXVAYJKFPC-OAQYLSRUSA-N.
| Molecular formula | C23H18N2O6 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-nitrophenyl)acetic acid |
| InChIKey | HEAJZXVAYJKFPC-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](C4=CC=C(C=C4)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)