CAS 2920045-74-3 is the registry number for THR-β agonist 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(4-hydroxy-1-methoxy-7-naphthalen-2-yloxyisoquinoline-3-carbonyl)amino]acetic acid (CAS 2920045-74-3) is a chemical compound with the molecular formula C23H18N2O6 and a molecular weight of 418.4 g/mol. IUPAC name: 2-[(4-hydroxy-1-methoxy-7-naphthalen-2-yloxyisoquinoline-3-carbonyl)amino]acetic acid. InChIKey: OJFUTFNCRATZLZ-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O6 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 2-[(4-hydroxy-1-methoxy-7-naphthalen-2-yloxyisoquinoline-3-carbonyl)amino]acetic acid |
| InChIKey | OJFUTFNCRATZLZ-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C2=C1C=C(C=C2)OC3=CC4=CC=CC=C4C=C3)O)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)