CAS 1344718-26-8 is the registry number for 5-(Trifluoromethylthio)indoline-2,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(trifluoromethylsulfanyl)-1H-indole-2,3-dione (CAS 1344718-26-8) is a chemical compound with the molecular formula C9H4F3NO2S and a molecular weight of 247.20 g/mol. IUPAC name: 5-(trifluoromethylsulfanyl)-1H-indole-2,3-dione. InChIKey: IWYVFRLMRWDBPI-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2S |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | 5-(trifluoromethylsulfanyl)-1H-indole-2,3-dione |
| InChIKey | IWYVFRLMRWDBPI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1SC(F)(F)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)