CAS 55439-75-3 appears in our catalog under these names: 2-(Trifluoromethyl)-1,3-benzothiazole-6-carboxylic acid, 95%, 2–(trifluoromethyl)–1,3–benzothiazole–6–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2-(trifluoromethyl)-1,3-benzothiazole-6-carboxylic acid (CAS 55439-75-3) is a chemical compound with the molecular formula C9H4F3NO2S and a molecular weight of 247.20 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzothiazole-6-carboxylic acid. InChIKey: GSINBWGBXZPBCL-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2S |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | GSINBWGBXZPBCL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)SC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)