Products 1781508-50-6
CAS 1781508-50-6 is the registry number for 2-(Trifluoromethyl)-1,3-benzothiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(trifluoromethyl)-1,3-benzothiazole-4-carboxylic acid (CAS 1781508-50-6) is a chemical compound with the molecular formula C9H4F3NO2S and a molecular weight of 247.20 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzothiazole-4-carboxylic acid. InChIKey: JFVHMQXKZFMJLR-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2S |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzothiazole-4-carboxylic acid |
| InChIKey | JFVHMQXKZFMJLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)