CAS 1344923-24-5 appears in our catalog under these names: (1S)-1-(4-(Phenylsulfanyl)phenyl)ethan-1-ol, 95%, (1S)-1-(4-(Phenylsulfanyl)phenyl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1S)-1-(4-phenylsulfanylphenyl)ethanol (CAS 1344923-24-5) is a chemical compound with the molecular formula C14H14OS and a molecular weight of 230.33 g/mol. IUPAC name: (1S)-1-(4-phenylsulfanylphenyl)ethanol. InChIKey: RCHMPJXXFCFXTH-NSHDSACASA-N.
| Molecular formula | C14H14OS |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | (1S)-1-(4-phenylsulfanylphenyl)ethanol |
| InChIKey | RCHMPJXXFCFXTH-NSHDSACASA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)SC2=CC=CC=C2)O |
Computed by PubChem (NCBI)