CAS 1774-35-2 appears in our catalog under these names: p–Tolyl sulfoxide, p-Tolyl Sulfoxide, >98.0%(GC), p-Tolyl Sulfoxide 98%, p-Tolyl Sulfoxide, 98%, 98%, 4,4'-Sulfinylbis(methylbenzene), 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 1g.
1-methyl-4-(4-methylphenyl)sulfinylbenzene (CAS 1774-35-2) is a chemical compound with the molecular formula C14H14OS and a molecular weight of 230.33 g/mol. IUPAC name: 1-methyl-4-(4-methylphenyl)sulfinylbenzene. InChIKey: MJWNJEJCQHNDNM-UHFFFAOYSA-N.
| Molecular formula | C14H14OS |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenyl)sulfinylbenzene |
| InChIKey | MJWNJEJCQHNDNM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)