CAS 1448251-16-8 is the registry number for 2-(1-(2,5-Dimethylthiophen-3-yl)vinyl)phenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
2-[1-(2,5-dimethylthiophen-3-yl)ethenyl]phenol (CAS 1448251-16-8) is a chemical compound with the molecular formula C14H14OS and a molecular weight of 230.33 g/mol. IUPAC name: 2-[1-(2,5-dimethylthiophen-3-yl)ethenyl]phenol. InChIKey: SRABAGCGOJXTPZ-UHFFFAOYSA-N.
| Molecular formula | C14H14OS |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | 2-[1-(2,5-dimethylthiophen-3-yl)ethenyl]phenol |
| InChIKey | SRABAGCGOJXTPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C(=C)C2=CC=CC=C2O |
Computed by PubChem (NCBI)