CAS 1345118-84-4 is the registry number for (3-(Furan-2-yl)-1-methyl-1H-pyrazol-5-yl)boronic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(furan-2-yl)-1-methylpyrazol-5-yl]boronic acid (CAS 1345118-84-4) is a chemical compound with the molecular formula C8H9BN2O3 and a molecular weight of 191.98 g/mol. IUPAC name: [3-(furan-2-yl)-1-methylpyrazol-5-yl]boronic acid. InChIKey: ZYXXCNXUSXQQGG-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O3 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | [3-(furan-2-yl)-1-methylpyrazol-5-yl]boronic acid |
| InChIKey | ZYXXCNXUSXQQGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NN1C)C2=CC=CO2)(O)O |
Computed by PubChem (NCBI)