Products 2121513-25-3
CAS 2121513-25-3 appears in our catalog under these names: 7-Methoxy-1h-indazole-4-boronic acid, 95%, (7-Methoxy-1H-indazol-4-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(7-methoxy-1H-indazol-4-yl)boronic acid (CAS 2121513-25-3) is a chemical compound with the molecular formula C8H9BN2O3 and a molecular weight of 191.98 g/mol. IUPAC name: (7-methoxy-1H-indazol-4-yl)boronic acid. InChIKey: DZMPENWGBBKCSU-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O3 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | (7-methoxy-1H-indazol-4-yl)boronic acid |
| InChIKey | DZMPENWGBBKCSU-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=NNC2=C(C=C1)OC)(O)O |
Computed by PubChem (NCBI)