CAS 2225170-35-2 is the registry number for 4–(4–Methylimidazol–1–yl)furan–2–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-(4-methylimidazol-1-yl)furan-2-yl]boronic acid (CAS 2225170-35-2) is a chemical compound with the molecular formula C8H9BN2O3 and a molecular weight of 191.98 g/mol. IUPAC name: [4-(4-methylimidazol-1-yl)furan-2-yl]boronic acid. InChIKey: QNKMBDNFJABDJD-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O3 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | [4-(4-methylimidazol-1-yl)furan-2-yl]boronic acid |
| InChIKey | QNKMBDNFJABDJD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CO1)N2C=C(N=C2)C)(O)O |
Computed by PubChem (NCBI)