Products 1345700-91-5
CAS 1345700-91-5 appears in our catalog under these names: (1-Oxo-1,3-dihydroisobenzofuran-5-yl)boronic acid, 98%, 98%, (1-Oxo-1,3-dihydroisobenzofuran-5-yl)boronic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
(1-oxo-3H-2-benzofuran-5-yl)boronic acid (CAS 1345700-91-5) is a chemical compound with the molecular formula C8H7BO4 and a molecular weight of 177.95 g/mol. IUPAC name: (1-oxo-3H-2-benzofuran-5-yl)boronic acid. InChIKey: WSBVMXFIZMNBML-UHFFFAOYSA-N.
| Molecular formula | C8H7BO4 |
|---|---|
| Molecular weight | 177.95 g/mol |
| IUPAC name | (1-oxo-3H-2-benzofuran-5-yl)boronic acid |
| InChIKey | WSBVMXFIZMNBML-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=O)OC2)(O)O |
Computed by PubChem (NCBI)