CAS 480424-62-2 appears in our catalog under these names: (3,5–Diformylphenyl)boronic acid, (3,5-Diformylphenyl)boronic acid, 98%, 98%, (3,5-Diformylphenyl)boronic acid, 97%, (3,5-Diformylphenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
(3,5-diformylphenyl)boronic acid (CAS 480424-62-2) is a chemical compound with the molecular formula C8H7BO4 and a molecular weight of 177.95 g/mol. IUPAC name: (3,5-diformylphenyl)boronic acid. InChIKey: RIFBPKDFVPXQQH-UHFFFAOYSA-N.
| Molecular formula | C8H7BO4 |
|---|---|
| Molecular weight | 177.95 g/mol |
| IUPAC name | (3,5-diformylphenyl)boronic acid |
| InChIKey | RIFBPKDFVPXQQH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C=O)C=O)(O)O |
Computed by PubChem (NCBI)