CAS 943311-49-7 appears in our catalog under these names: 5,10,12-Trioxa-4-boratricyclo(7.3.0.0,3,7)dodeca-1,3(7),8-trien-4-ol, 95%, 5,10,12-Trioxa-4-boratricyclo(7.3.0.0,3,7)dodeca-1(9),2,7-trien-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole (CAS 943311-49-7) is a chemical compound with the molecular formula C8H7BO4 and a molecular weight of 177.95 g/mol. IUPAC name: 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole. InChIKey: DCUIAAXHLXHQLR-UHFFFAOYSA-N.
| Molecular formula | C8H7BO4 |
|---|---|
| Molecular weight | 177.95 g/mol |
| IUPAC name | 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole |
| InChIKey | DCUIAAXHLXHQLR-UHFFFAOYSA-N |
| SMILES | B1(C2=CC3=C(C=C2CO1)OCO3)O |
Computed by PubChem (NCBI)