CAS 134575-37-4 appears in our catalog under these names: (1R,5S,6R)-3-Tert-Butyl 6-Ethyl 3-Azabicyclo[3.1.0]Hexane-3,6-Dicarboxylate, 95%, 95%, rel-3-(tert-Butyl) 6-ethyl (1R,5S,6r)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-O-tert-butyl 6-O-ethyl (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate (CAS 134575-37-4) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 3-O-tert-butyl 6-O-ethyl (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate. InChIKey: SESCEXYKMJZFEE-ULKQDVFKSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 3-O-tert-butyl 6-O-ethyl (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate |
| InChIKey | SESCEXYKMJZFEE-ULKQDVFKSA-N |
| SMILES | CCOC(=O)C1[C@H]2[C@@H]1CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)