Products 134589-53-0

CAS 134589-53-0 appears in our catalog under these names: 3,5-Dichloro-1-methyl-1H-pyrazole-4-carboxylic acid, 95%, 3,5-Dichloro-1-methyl-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.

3,5-dichloro-1-methylpyrazole-4-carboxylic acid (CAS 134589-53-0) is a chemical compound with the molecular formula C5H4Cl2N2O2 and a molecular weight of 195.00 g/mol. IUPAC name: 3,5-dichloro-1-methylpyrazole-4-carboxylic acid. InChIKey: MMDIWOSRSLNHLA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4Cl2N2O2
Molecular weight195.00 g/mol
IUPAC name3,5-dichloro-1-methylpyrazole-4-carboxylic acid
InChIKeyMMDIWOSRSLNHLA-UHFFFAOYSA-N
SMILESCN1C(=C(C(=N1)Cl)C(=O)O)Cl

Computed by PubChem (NCBI)