Products 1547701-65-4

CAS 1547701-65-4 is the registry number for 2,4-Dichloro-1-methyl-1H-imidazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,5-dichloro-3-methylimidazole-4-carboxylic acid (CAS 1547701-65-4) is a chemical compound with the molecular formula C5H4Cl2N2O2 and a molecular weight of 195.00 g/mol. IUPAC name: 2,5-dichloro-3-methylimidazole-4-carboxylic acid. InChIKey: ZFRHQOQWOTVFKP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4Cl2N2O2
Molecular weight195.00 g/mol
IUPAC name2,5-dichloro-3-methylimidazole-4-carboxylic acid
InChIKeyZFRHQOQWOTVFKP-UHFFFAOYSA-N
SMILESCN1C(=C(N=C1Cl)Cl)C(=O)O

Computed by PubChem (NCBI)