CAS 54079-68-4 appears in our catalog under these names: 4-Chloro-3-nitropyridine hydrochloride, 4-Chloro-3-nitropyridine hydrochloride, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-chloro-3-nitropyridine;hydrochloride (CAS 54079-68-4) is a chemical compound with the molecular formula C5H4Cl2N2O2 and a molecular weight of 195.00 g/mol. IUPAC name: 4-chloro-3-nitropyridine;hydrochloride. InChIKey: YTPDMOPPRVGKEW-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N2O2 |
|---|---|
| Molecular weight | 195.00 g/mol |
| IUPAC name | 4-chloro-3-nitropyridine;hydrochloride |
| InChIKey | YTPDMOPPRVGKEW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1Cl)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)