Products 1346112-79-5
CAS 1346112-79-5 appears in our catalog under these names: Thromboxane B2-d4, Thromboxane B2-SIL, Thromboxane B2–d4, Thromboxane B2-d4, 99.9%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 5mg, 25ug, 50ug, 100ug, 1mg, 25 μg (267.02 μM * 250 μL in Methyl acetate).
(Z)-3,3,4,4-tetradeuterio-7-[(2R,3S,4S)-4,6-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]oxan-3-yl]hept-5-enoic acid (CAS 1346112-79-5) is a chemical compound with the molecular formula C20H34O6 and a molecular weight of 374.5 g/mol. IUPAC name: (Z)-3,3,4,4-tetradeuterio-7-[(2R,3S,4S)-4,6-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]oxan-3-yl]hept-5-enoic acid. InChIKey: XNRNNGPBEPRNAR-LCGOHBJFSA-N.
| Molecular formula | C20H34O6 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | (Z)-3,3,4,4-tetradeuterio-7-[(2R,3S,4S)-4,6-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]oxan-3-yl]hept-5-enoic acid |
| InChIKey | XNRNNGPBEPRNAR-LCGOHBJFSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])/C=C\C[C@H]1[C@H](CC(O[C@@H]1/C=C/[C@H](CCCCC)O)O)O |
Computed by PubChem (NCBI)