CAS 63983-53-9 appears in our catalog under these names: 6,15-diketo-13,14-dihydro Prostaglandin F1α, 6,15–diketo–13,14–dihydro Prostaglandin F1α. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 100ug, 500ug, 100μg, 500μg, Get quote.
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]-6-oxoheptanoic acid (CAS 63983-53-9) is a chemical compound with the molecular formula C20H34O6 and a molecular weight of 370.5 g/mol. IUPAC name: 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]-6-oxoheptanoic acid. InChIKey: KBHLXKOKUVJZIS-MKXGPGLRSA-N.
| Molecular formula | C20H34O6 |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]-6-oxoheptanoic acid |
| InChIKey | KBHLXKOKUVJZIS-MKXGPGLRSA-N |
| SMILES | CCCCCC(=O)CC[C@H]1[C@@H](C[C@@H]([C@@H]1CC(=O)CCCCC(=O)O)O)O |
Computed by PubChem (NCBI)