CAS 82414-64-0 appears in our catalog under these names: 6–keto Prostaglandin F1α–d4, 6-keto Prostaglandin F1α-d4, 99.9%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 25μg, 50μg, 100μg, 1mg, 25 μg (267.02 μM * 250 μL in Methyl acetate).
3,3,4,4-tetradeuterio-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoic acid (CAS 82414-64-0) is a chemical compound with the molecular formula C20H34O6 and a molecular weight of 374.5 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoic acid. InChIKey: KFGOFTHODYBSGM-GKZGVFJGSA-N.
| Molecular formula | C20H34O6 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoic acid |
| InChIKey | KFGOFTHODYBSGM-GKZGVFJGSA-N |
| SMILES | [2H]C([2H])(CC(=O)C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@H](CCCCC)O)O)O)C([2H])([2H])CC(=O)O |
Computed by PubChem (NCBI)