Products 1346146-41-5
CAS 1346146-41-5 is the registry number for 1-(3-bromophenyl)-2-(hydroxymethyl)cyclopropanecarboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3-bromophenyl)-2-(hydroxymethyl)cyclopropane-1-carboxamide (CAS 1346146-41-5) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 1-(3-bromophenyl)-2-(hydroxymethyl)cyclopropane-1-carboxamide. InChIKey: SRGDGGYDYVNHRL-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2-(hydroxymethyl)cyclopropane-1-carboxamide |
| InChIKey | SRGDGGYDYVNHRL-UHFFFAOYSA-N |
| SMILES | C1C(C1(C2=CC(=CC=C2)Br)C(=O)N)CO |
Computed by PubChem (NCBI)