Products 1346270-24-3
CAS 1346270-24-3 is the registry number for 1H-Pyrazole-3-carboxamide, 5-(5-methyl-2-furanyl)-, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide (CAS 1346270-24-3) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide. InChIKey: JPMMMRIYZDXZKK-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
| InChIKey | JPMMMRIYZDXZKK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=CC(=NN2)C(=O)N |
Computed by PubChem (NCBI)