Products 1346447-05-9
CAS 1346447-05-9 is the registry number for 6-Iodo-3,4-dihydro-2h-pyrano[3,2-b]pyridin-8-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-iodo-2,3,4,5-tetrahydropyrano[3,2-b]pyridin-8-one (CAS 1346447-05-9) is a chemical compound with the molecular formula C8H8INO2 and a molecular weight of 277.06 g/mol. IUPAC name: 6-iodo-2,3,4,5-tetrahydropyrano[3,2-b]pyridin-8-one. InChIKey: NSELKNWUDPHKSS-UHFFFAOYSA-N.
| Molecular formula | C8H8INO2 |
|---|---|
| Molecular weight | 277.06 g/mol |
| IUPAC name | 6-iodo-2,3,4,5-tetrahydropyrano[3,2-b]pyridin-8-one |
| InChIKey | NSELKNWUDPHKSS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C=C(N2)I)OC1 |
Computed by PubChem (NCBI)