Products 1708958-92-2

CAS 1708958-92-2 is the registry number for 2-Amino-5-iodo-4-methyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-amino-5-iodo-4-methylbenzoic acid (CAS 1708958-92-2) is a chemical compound with the molecular formula C8H8INO2 and a molecular weight of 277.06 g/mol. IUPAC name: 2-amino-5-iodo-4-methylbenzoic acid. InChIKey: YKMLNUQPPGDJJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8INO2
Molecular weight277.06 g/mol
IUPAC name2-amino-5-iodo-4-methylbenzoic acid
InChIKeyYKMLNUQPPGDJJJ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1I)C(=O)O)N

Computed by PubChem (NCBI)