Products 1934511-55-3

CAS 1934511-55-3 is the registry number for 4-Amino-5-iodo-2-methyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

4-amino-5-iodo-2-methylbenzoic acid (CAS 1934511-55-3) is a chemical compound with the molecular formula C8H8INO2 and a molecular weight of 277.06 g/mol. IUPAC name: 4-amino-5-iodo-2-methylbenzoic acid. InChIKey: GVWOLRLFCDZKDE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8INO2
Molecular weight277.06 g/mol
IUPAC name4-amino-5-iodo-2-methylbenzoic acid
InChIKeyGVWOLRLFCDZKDE-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C(=O)O)I)N

Computed by PubChem (NCBI)