Products 1346447-20-8
CAS 1346447-20-8 is the registry number for 6-Chloro-n-methoxy-n-methyl-5-pivalamidopicolinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-chloro-5-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-2-carboxamide (CAS 1346447-20-8) is a chemical compound with the molecular formula C13H18ClN3O3 and a molecular weight of 299.75 g/mol. IUPAC name: 6-chloro-5-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-2-carboxamide. InChIKey: JDYMMKFLTXMPGW-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3O3 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 6-chloro-5-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-2-carboxamide |
| InChIKey | JDYMMKFLTXMPGW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=C(C=C1)C(=O)N(C)OC)Cl |
Computed by PubChem (NCBI)