CAS 2766211-53-2 is the registry number for tert-Butyl 2-chloro-4-methoxy-5,8-dihydropyrido[3,4-d]pyrimidine-7(6H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chloro-4-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (CAS 2766211-53-2) is a chemical compound with the molecular formula C13H18ClN3O3 and a molecular weight of 299.75 g/mol. IUPAC name: tert-butyl 2-chloro-4-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate. InChIKey: WBICHYWNESBXQJ-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3O3 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | tert-butyl 2-chloro-4-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| InChIKey | WBICHYWNESBXQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=C(N=C2OC)Cl |
Computed by PubChem (NCBI)