Products 1980053-66-4
CAS 1980053-66-4 appears in our catalog under these names: N'-(4-Chloro-3-nitrophenyl)-n,n-diisopropylurea, 95%, N'-(4-Chloro-3-nitrophenyl)-N,N-diisopropylurea, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(4-chloro-3-nitrophenyl)-1,1-di(propan-2-yl)urea (CAS 1980053-66-4) is a chemical compound with the molecular formula C13H18ClN3O3 and a molecular weight of 299.75 g/mol. IUPAC name: 3-(4-chloro-3-nitrophenyl)-1,1-di(propan-2-yl)urea. InChIKey: ZXGDCYWULGRADW-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3O3 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 3-(4-chloro-3-nitrophenyl)-1,1-di(propan-2-yl)urea |
| InChIKey | ZXGDCYWULGRADW-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)NC1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)