CAS 1398065-94-5 appears in our catalog under these names: Phthalic Acid 8-Methylnonyl Ester-d4, Monoisodecyl Phthalate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 2.5 mg.
2,3,4,5-tetradeuterio-6-(8-methylnonoxycarbonyl)benzoic acid (CAS 1398065-94-5) is a chemical compound with the molecular formula C18H26O4 and a molecular weight of 310.4 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(8-methylnonoxycarbonyl)benzoic acid. InChIKey: ZICLWBMRDQUIDO-CXRURWBMSA-N.
| Molecular formula | C18H26O4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(8-methylnonoxycarbonyl)benzoic acid |
| InChIKey | ZICLWBMRDQUIDO-CXRURWBMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCCCCCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)