Products 1346598-33-1
CAS 1346598-33-1 is the registry number for 4-Fluoro Methamphetamine-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 50mg, 5mg.
1-(4-fluorophenyl)-N-(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 1346598-33-1) is a chemical compound with the molecular formula C10H15ClFN and a molecular weight of 206.70 g/mol. IUPAC name: 1-(4-fluorophenyl)-N-(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: ATENQHYHZHUQLJ-MUTAZJQDSA-N.
| Molecular formula | C10H15ClFN |
|---|---|
| Molecular weight | 206.70 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-N-(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | ATENQHYHZHUQLJ-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)CC1=CC=C(C=C1)F.Cl |
Computed by PubChem (NCBI)