Products 1346598-73-9
CAS 1346598-73-9 appears in our catalog under these names: Dimethyl Phthalate-13C2, >95% (HPLC), Dimethyl Phthalate-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 50 mg, 100 mg, 10 mg.
Di(113C)methyl benzene-1,2-dicarboxylate (CAS 1346598-73-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 196.17 g/mol. IUPAC name: di(113C)methyl benzene-1,2-dicarboxylate. InChIKey: NIQCNGHVCWTJSM-ZDOIIHCHSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | di(113C)methyl benzene-1,2-dicarboxylate |
| InChIKey | NIQCNGHVCWTJSM-ZDOIIHCHSA-N |
| SMILES | [13CH3]OC(=O)C1=CC=CC=C1C(=O)O[13CH3] |
Computed by PubChem (NCBI)