Products 85448-30-2
CAS 85448-30-2 appears in our catalog under these names: Dimethyl-d6 Phthalate, 99 atom % D, min 98% Chemical Purity, Phthalic Acid Di(methyl-d3) Ester, >95% (HPLC), Dimethyl phthalate–d6, Dimethyl phthalate-d6. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 0,1g, 10mg, 1mg, 5mg, 5 mg.
Bis(trideuteriomethyl) benzene-1,2-dicarboxylate (CAS 85448-30-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 200.22 g/mol. IUPAC name: bis(trideuteriomethyl) benzene-1,2-dicarboxylate. InChIKey: NIQCNGHVCWTJSM-WFGJKAKNSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | bis(trideuteriomethyl) benzene-1,2-dicarboxylate |
| InChIKey | NIQCNGHVCWTJSM-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C1=CC=CC=C1C(=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)