Products 1346598-90-0

CAS 1346598-90-0 is the registry number for Ibuprofen EP Impurity A-d3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,3,3-trideuterio-2-[3-(2-methylpropyl)phenyl]propanoic acid (CAS 1346598-90-0) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 209.30 g/mol. IUPAC name: 3,3,3-trideuterio-2-[3-(2-methylpropyl)phenyl]propanoic acid. InChIKey: SFVKLYXPBKITCE-HPRDVNIFSA-N.

Identity
Molecular formulaC13H18O2
Molecular weight209.30 g/mol
IUPAC name3,3,3-trideuterio-2-[3-(2-methylpropyl)phenyl]propanoic acid
InChIKeySFVKLYXPBKITCE-HPRDVNIFSA-N
SMILES[2H]C([2H])([2H])C(C1=CC=CC(=C1)CC(C)C)C(=O)O

Computed by PubChem (NCBI)