CAS 1346598-90-0 is the registry number for Ibuprofen EP Impurity A-d3. Offered by: Chemat Brand. Available pack sizes: on request.
3,3,3-trideuterio-2-[3-(2-methylpropyl)phenyl]propanoic acid (CAS 1346598-90-0) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 209.30 g/mol. IUPAC name: 3,3,3-trideuterio-2-[3-(2-methylpropyl)phenyl]propanoic acid. InChIKey: SFVKLYXPBKITCE-HPRDVNIFSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 209.30 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[3-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | SFVKLYXPBKITCE-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=CC(=C1)CC(C)C)C(=O)O |
Computed by PubChem (NCBI)