Products 66622-47-7
CAS 66622-47-7 appears in our catalog under these names: 2-(3-Isobutylphenyl)propanoic acid, 95%, Ibuprofen EP Impurity A, m-Isobutyl Ibuprofen, >95% (HPLC), (2RS)-2-(3-(2-Methylpropyl)phenyl)propanoic Acid, m–isobutyl Ibuprofen. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg, on request, 25mg, 10mg, 5mg.
2-[3-(2-methylpropyl)phenyl]propanoic acid (CAS 66622-47-7) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 2-[3-(2-methylpropyl)phenyl]propanoic acid. InChIKey: SFVKLYXPBKITCE-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2-[3-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | SFVKLYXPBKITCE-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC(=CC=C1)C(C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-[3-(2-methylpropyl)phenyl]propanoic Acid, 2-(3-(2-Methylpropyl)phenyl)propanoic acid, 2-(3-isobutylphenyl)propanoic acid, m-Isobutyl Ibuprofen, 2-(3-Isobutylphenyl)propionic Acid, Ibuprofen EP Impurity A, m-IsobutylIbuprofen-d3, (2RS)-2-(3-(2-Methylpropyl)phenyl)propanoic acid, (2RS)-2-[3-(2-Methylpropyl)phenyl] propanoic acid, (2RS)-2-[3-(2-Methylpropyl)phenyl]propanoic Acid