Products 1346598-94-4
CAS 1346598-94-4 appears in our catalog under these names: 4-Acetyl Ramelteon, Ramelteon Impurity D, Ramelteon Impurity 22. Offered by: Chemat Brand, TRC, Biosynth, Hubei YoungXin. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 200mg.
N-[2-[(8S)-4-acetyl-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 1346598-94-4) is a chemical compound with the molecular formula C18H23NO3 and a molecular weight of 301.4 g/mol. IUPAC name: N-[2-[(8S)-4-acetyl-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: TYKIXTOHVJPYMI-LBPRGKRZSA-N.
| Molecular formula | C18H23NO3 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | N-[2-[(8S)-4-acetyl-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | TYKIXTOHVJPYMI-LBPRGKRZSA-N |
| SMILES | CCC(=O)NCC[C@@H]1CCC2=CC(=C3C(=C12)CCO3)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
4-Acetyl Ramelteon