CAS 849630-94-0 appears in our catalog under these names: N-Methyl Etodolac, Etodolac Impurity 13. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
2-(1,8-diethyl-9-methyl-3,4-dihydropyrano[3,4-b]indol-1-yl)acetic acid (CAS 849630-94-0) is a chemical compound with the molecular formula C18H23NO3 and a molecular weight of 301.4 g/mol. IUPAC name: 2-(1,8-diethyl-9-methyl-3,4-dihydropyrano[3,4-b]indol-1-yl)acetic acid. InChIKey: FVGKDAYQHVFRGK-UHFFFAOYSA-N.
| Molecular formula | C18H23NO3 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 2-(1,8-diethyl-9-methyl-3,4-dihydropyrano[3,4-b]indol-1-yl)acetic acid |
| InChIKey | FVGKDAYQHVFRGK-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C3=C(N2C)C(OCC3)(CC)CC(=O)O |
Computed by PubChem (NCBI)