CAS 57816-83-8 appears in our catalog under these names: Etodolac EP Impurity G (1-Propyl Etodolac), Etodolac EP Impurity G, Etodolac Impurity 7 （Etodolac EP Impurity G), 1-Propyl Etodolac, >95% (HPLC), 2-((1RS)-8-Ethyl-1-propyl-1,3,4,9-tetrahydropyrano(3,4-b)indol-1-yl)acetic Acid (1-Propyl Etodolac). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(8-ethyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid (CAS 57816-83-8) is a chemical compound with the molecular formula C18H23NO3 and a molecular weight of 301.4 g/mol. IUPAC name: 2-(8-ethyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid. InChIKey: YJAXAFPOOSEKDP-UHFFFAOYSA-N.
| Molecular formula | C18H23NO3 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 2-(8-ethyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid |
| InChIKey | YJAXAFPOOSEKDP-UHFFFAOYSA-N |
| SMILES | CCCC1(C2=C(CCO1)C3=CC=CC(=C3N2)CC)CC(=O)O |
Computed by PubChem (NCBI)