Products 1346598-98-8
CAS 1346598-98-8 appears in our catalog under these names: 1,5-Diaminonaphthalene-d6, >95% (HPLC), Naphthalene-1,5-diamine-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
2,3,4,6,7,8-hexadeuterionaphthalene-1,5-diamine (CAS 1346598-98-8) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 164.24 g/mol. IUPAC name: 2,3,4,6,7,8-hexadeuterionaphthalene-1,5-diamine. InChIKey: KQSABULTKYLFEV-MZWXYZOWSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 164.24 g/mol |
| IUPAC name | 2,3,4,6,7,8-hexadeuterionaphthalene-1,5-diamine |
| InChIKey | KQSABULTKYLFEV-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C(C(=C2N)[2H])[2H])[2H])C(=C1[2H])N)[2H] |
Computed by PubChem (NCBI)