Products 1346599-55-0
CAS 1346599-55-0 is the registry number for 2-Fluoroephedrone-d3 hydrochloride. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
1-(2-fluorophenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride (CAS 1346599-55-0) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 220.68 g/mol. IUPAC name: 1-(2-fluorophenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride. InChIKey: VQPJZZKUYWXXOY-MUTAZJQDSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride |
| InChIKey | VQPJZZKUYWXXOY-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)C(=O)C1=CC=CC=C1F.Cl |
Computed by PubChem (NCBI)