CAS 1346600-25-6 is the registry number for 3-(4-Chlorophenyl-d4)-4-hydroxybutyric Acid Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
Sodium 3-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxybutanoate (CAS 1346600-25-6) is a chemical compound with the molecular formula C10H10ClNaO3 and a molecular weight of 240.65 g/mol. IUPAC name: sodium 3-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxybutanoate. InChIKey: YNPCWJFLKBMRIL-FOMJDCLLSA-M.
| Molecular formula | C10H10ClNaO3 |
|---|---|
| Molecular weight | 240.65 g/mol |
| IUPAC name | sodium 3-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxybutanoate |
| InChIKey | YNPCWJFLKBMRIL-FOMJDCLLSA-M |
| SMILES | [2H]C1=C(C(=C(C(=C1C(CC(=O)[O-])CO)[2H])[2H])Cl)[2H].[Na+] |
Computed by PubChem (NCBI)