CAS 1346603-21-1 appears in our catalog under these names: 3–(4–Chlorophenyl)–4–hydroxybutyric Acid (sodium salt), 3-(4-Chlorophenyl)-4-hydroxybutyric Acid Sodium Salt, >95% (HPLC), 3-(4-Chlorophenyl)-4-hydroxybutyric Acid (sodium salt), 3-(4-Chlorophenyl)-4-hydroxybutyric acid (sodium). Offered by: GLPBio, TRC, TargetMol, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 25mg, 2500ug, 5mg, 500μg, 1 mg, 500 μg.
Sodium 3-(4-chlorophenyl)-4-hydroxybutanoate (CAS 1346603-21-1) is a chemical compound with the molecular formula C10H10ClNaO3 and a molecular weight of 236.63 g/mol. IUPAC name: sodium 3-(4-chlorophenyl)-4-hydroxybutanoate. InChIKey: YNPCWJFLKBMRIL-UHFFFAOYSA-M.
| Molecular formula | C10H10ClNaO3 |
|---|---|
| Molecular weight | 236.63 g/mol |
| IUPAC name | sodium 3-(4-chlorophenyl)-4-hydroxybutanoate |
| InChIKey | YNPCWJFLKBMRIL-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(CC(=O)[O-])CO)Cl.[Na+] |
Computed by PubChem (NCBI)