CAS 1346617-22-8 is the registry number for (R)-3-(4-Chlorophenyl)-4-hydroxybutyric Acid Sodium Salt. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Sodium (3R)-3-(4-chlorophenyl)-4-hydroxybutanoate (CAS 1346617-22-8) is a chemical compound with the molecular formula C10H10ClNaO3 and a molecular weight of 236.63 g/mol. IUPAC name: sodium (3R)-3-(4-chlorophenyl)-4-hydroxybutanoate. InChIKey: YNPCWJFLKBMRIL-QRPNPIFTSA-M.
| Molecular formula | C10H10ClNaO3 |
|---|---|
| Molecular weight | 236.63 g/mol |
| IUPAC name | sodium (3R)-3-(4-chlorophenyl)-4-hydroxybutanoate |
| InChIKey | YNPCWJFLKBMRIL-QRPNPIFTSA-M |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)[O-])CO)Cl.[Na+] |
Computed by PubChem (NCBI)