CAS 1346600-75-6 is the registry number for 3-Benzoylpropanoic Acid-13C6. Offered by: TRC. Available pack sizes: 250mg, 25mg.
4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-oxobutanoic acid (CAS 1346600-75-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 184.14 g/mol. IUPAC name: 4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-oxobutanoic acid. InChIKey: KMQLIDDEQAJAGJ-DEHIIRIRSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-oxobutanoic acid |
| InChIKey | KMQLIDDEQAJAGJ-DEHIIRIRSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)