Products 1346600-75-6

CAS 1346600-75-6 is the registry number for 3-Benzoylpropanoic Acid-13C6. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-oxobutanoic acid (CAS 1346600-75-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 184.14 g/mol. IUPAC name: 4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-oxobutanoic acid. InChIKey: KMQLIDDEQAJAGJ-DEHIIRIRSA-N.

Identity
Molecular formulaC10H10O3
Molecular weight184.14 g/mol
IUPAC name4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-oxobutanoic acid
InChIKeyKMQLIDDEQAJAGJ-DEHIIRIRSA-N
SMILES[13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(=O)CCC(=O)O

Computed by PubChem (NCBI)